C29H18N2O2S3 — CID 171365975
(Z)-2-cyano-3-[4-[5-(10-methylphenothiazin-3-yl)thieno[3,2-b]thiophen-2-yl]phenyl]prop-2-enoic acid (PubChem CID 171365975) has the molecular formula C29H18N2O2S3 and a molecular weight of 522.68 g/mol. Its IUPAC name is (Z)-2-cyano-3-[4-[5-(10-methylphenothiazin-3-yl)thieno[3,2-b]thiophen-2-yl]phenyl]prop-2-enoic acid.
| Compound Name | (Z)-2-cyano-3-[4-[5-(10-methylphenothiazin-3-yl)thieno[3,2-b]thiophen-2-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 171365975 |
| Molecular Formula | C29H18N2O2S3 |
| Molecular Weight | 522.68 g/mol |
| Exact Mass | 522.05 |
| IUPAC Name | (Z)-2-cyano-3-[4-[5-(10-methylphenothiazin-3-yl)thieno[3,2-b]thiophen-2-yl]phenyl]prop-2-enoic acid |
| SMILES | CN1c2ccccc2Sc2cc(-c3cc4sc(-c5ccc(/C=C(/C#N)C(=O)O)cc5)cc4s3)ccc21 |
| InChI | InChI=1S/C29H18N2O2S3/c1-31-21-4-2-3-5-23(21)34-26-13-19(10-11-22(26)31)25-15-28-27(36-25)14-24(35-28)18-8-6-17(7-9-18)12-20(16-30)29(32)33/h2-15H,1H3,(H,32,33)/b20-12- |
| InChIKey | AICMYFMGVBQCAG-NDENLUEZSA-N |
| XLogP | 8.52 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.68 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|