C24H15NO2S2 — CID 177389187
(Z)-3-[4-[4-(1,3-benzodithiol-2-ylidenemethyl)phenyl]phenyl]-2-cyanoprop-2-enoic acid (PubChem CID 177389187) has the molecular formula C24H15NO2S2 and a molecular weight of 413.52 g/mol. Its IUPAC name is (Z)-3-[4-[4-(1,3-benzodithiol-2-ylidenemethyl)phenyl]phenyl]-2-cyanoprop-2-enoic acid.
| Compound Name | (Z)-3-[4-[4-(1,3-benzodithiol-2-ylidenemethyl)phenyl]phenyl]-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 177389187 |
| Molecular Formula | C24H15NO2S2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | (Z)-3-[4-[4-(1,3-benzodithiol-2-ylidenemethyl)phenyl]phenyl]-2-cyanoprop-2-enoic acid |
| SMILES | N#C/C(=C/c1ccc(-c2ccc(C=C3Sc4ccccc4S3)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C24H15NO2S2/c25-15-20(24(26)27)13-16-5-9-18(10-6-16)19-11-7-17(8-12-19)14-23-28-21-3-1-2-4-22(21)29-23/h1-14H,(H,26,27)/b20-13- |
| InChIKey | IREZWVDHRPFKAO-MOSHPQCFSA-N |
| XLogP | 6.54 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|