C40H39NO2S7 — CID 177385531
(Z)-3-[4-[10-[4-[[4,5-bis(hexylsulfanyl)-1,3-dithiol-2-ylidene]methyl]phenyl]-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]phenyl]-2-cyanoprop-2-enoic acid (PubChem CID 177385531) has the molecular formula C40H39NO2S7 and a molecular weight of 790.23 g/mol. Its IUPAC name is (Z)-3-[4-[10-[4-[[4,5-bis(hexylsulfanyl)-1,3-dithiol-2-ylidene]methyl]phenyl]-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]phenyl]-2-cyanoprop-2-enoic acid.
| Compound Name | (Z)-3-[4-[10-[4-[[4,5-bis(hexylsulfanyl)-1,3-dithiol-2-ylidene]methyl]phenyl]-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]phenyl]-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 177385531 |
| Molecular Formula | C40H39NO2S7 |
| Molecular Weight | 790.23 g/mol |
| Exact Mass | 789.10 |
| IUPAC Name | (Z)-3-[4-[10-[4-[[4,5-bis(hexylsulfanyl)-1,3-dithiol-2-ylidene]methyl]phenyl]-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]phenyl]-2-cyanoprop-2-enoic acid |
| SMILES | CCCCCCSC1=C(SCCCCCC)SC(=Cc2ccc(-c3cc4sc5cc(-c6ccc(/C=C(/C#N)C(=O)O)cc6)sc5c4s3)cc2)S1 |
| InChI | InChI=1S/C40H39NO2S7/c1-3-5-7-9-19-44-39-40(45-20-10-8-6-4-2)50-35(49-39)22-27-13-17-29(18-14-27)32-24-34-37(48-32)36-33(46-34)23-31(47-36)28-15-11-26(12-16-28)21-30(25-41)38(42)43/h11-18,21-24H,3-10,19-20H2,1-2H3,(H,42,43)/b30-21- |
| InChIKey | OTCKFPOFSYMWBX-OFWBYEQRSA-N |
| XLogP | 15.04 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.23 |
| LogP ≤ 5 | 15.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|