C43H33NOS2 — CID 58988517
5-[6-[bis(9,9-dimethylfluoren-2-yl)amino]-1-benzothiophen-2-yl]thiophene-2-carbaldehyde (PubChem CID 58988517) has the molecular formula C43H33NOS2 and a molecular weight of 643.88 g/mol. Its IUPAC name is 5-[6-[bis(9,9-dimethylfluoren-2-yl)amino]-1-benzothiophen-2-yl]thiophene-2-carbaldehyde.
| Compound Name | 5-[6-[bis(9,9-dimethylfluoren-2-yl)amino]-1-benzothiophen-2-yl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 58988517 |
| Molecular Formula | C43H33NOS2 |
| Molecular Weight | 643.88 g/mol |
| Exact Mass | 643.20 |
| IUPAC Name | 5-[6-[bis(9,9-dimethylfluoren-2-yl)amino]-1-benzothiophen-2-yl]thiophene-2-carbaldehyde |
| SMILES | CC1(C)c2ccccc2-c2ccc(N(c3ccc4c(c3)C(C)(C)c3ccccc3-4)c3ccc4cc(-c5ccc(C=O)s5)sc4c3)cc21 |
| InChI | InChI=1S/C43H33NOS2/c1-42(2)35-11-7-5-9-31(35)33-18-15-27(22-37(33)42)44(28-16-19-34-32-10-6-8-12-36(32)43(3,4)38(34)23-28)29-14-13-26-21-41(47-40(26)24-29)39-20-17-30(25-45)46-39/h5-25H,1-4H3 |
| InChIKey | DZUREVIJLGUDRG-UHFFFAOYSA-N |
| XLogP | 12.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.88 |
| LogP ≤ 5 | 12.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|