C45H33NO2 — CID 58175017
2-[[6-(4-phenyl-N-(2,4,6-trimethylphenyl)anilino)naphthalen-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione (PubChem CID 58175017) has the molecular formula C45H33NO2 and a molecular weight of 619.76 g/mol. Its IUPAC name is 2-[[6-(4-phenyl-N-(2,4,6-trimethylphenyl)anilino)naphthalen-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione.
| Compound Name | 2-[[6-(4-phenyl-N-(2,4,6-trimethylphenyl)anilino)naphthalen-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione |
|---|---|
| PubChem CID | 58175017 |
| Molecular Formula | C45H33NO2 |
| Molecular Weight | 619.76 g/mol |
| Exact Mass | 619.25 |
| IUPAC Name | 2-[[6-(4-phenyl-N-(2,4,6-trimethylphenyl)anilino)naphthalen-2-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione |
| SMILES | Cc1cc(C)c(N(c2ccc(-c3ccccc3)cc2)c2ccc3cc(C=C4C(=O)c5cc6ccccc6cc5C4=O)ccc3c2)c(C)c1 |
| InChI | InChI=1S/C45H33NO2/c1-28-21-29(2)43(30(3)22-28)46(38-18-15-33(16-19-38)32-9-5-4-6-10-32)39-20-17-36-23-31(13-14-37(36)25-39)24-42-44(47)40-26-34-11-7-8-12-35(34)27-41(40)45(42)48/h4-27H,1-3H3 |
| InChIKey | CACUVKGLCCZXGS-UHFFFAOYSA-N |
| XLogP | 11.52 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.76 |
| LogP ≤ 5 | 11.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|