C14H17NO — CID 142271193
(2E,3Z)-2,3-di(ethylidene)inden-1-one;methanamine (PubChem CID 142271193) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is (2E,3Z)-2,3-di(ethylidene)inden-1-one;methanamine.
| Compound Name | (2E,3Z)-2,3-di(ethylidene)inden-1-one;methanamine |
|---|---|
| PubChem CID | 142271193 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | (2E,3Z)-2,3-di(ethylidene)inden-1-one;methanamine |
| SMILES | C/C=C1C(=C/C)\C(=O)c2ccccc2\1.CN |
| InChI | InChI=1S/C13H12O.CH5N/c1-3-9-10(4-2)13(14)12-8-6-5-7-11(9)12;1-2/h3-8H,1-2H3;2H2,1H3/b9-3+,10-4+; |
| InChIKey | NYLXIIPXWLQEBO-RUACYTINSA-N |
| XLogP | 2.81 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|