C29H28O6 — CID 139785661
2-methoxy-3-[1-(3-methoxy-1,4-dioxonaphthalen-2-yl)-2,3-dimethylpentyl]naphthalene-1,4-dione (PubChem CID 139785661) has the molecular formula C29H28O6 and a molecular weight of 472.54 g/mol. Its IUPAC name is 2-methoxy-3-[1-(3-methoxy-1,4-dioxonaphthalen-2-yl)-2,3-dimethylpentyl]naphthalene-1,4-dione.
| Compound Name | 2-methoxy-3-[1-(3-methoxy-1,4-dioxonaphthalen-2-yl)-2,3-dimethylpentyl]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 139785661 |
| Molecular Formula | C29H28O6 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 2-methoxy-3-[1-(3-methoxy-1,4-dioxonaphthalen-2-yl)-2,3-dimethylpentyl]naphthalene-1,4-dione |
| SMILES | CCC(C)C(C)C(C1=C(OC)C(=O)c2ccccc2C1=O)C1=C(OC)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C29H28O6/c1-6-15(2)16(3)21(22-24(30)17-11-7-9-13-19(17)26(32)28(22)34-4)23-25(31)18-12-8-10-14-20(18)27(33)29(23)35-5/h7-16,21H,6H2,1-5H3 |
| InChIKey | NTMWQXDHWRYLTI-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|