C14H12Br2O — CID 90975189
1,4-dibromo-2-(5-methoxy-2-methylphenyl)benzene (PubChem CID 90975189) has the molecular formula C14H12Br2O and a molecular weight of 356.06 g/mol. Its IUPAC name is 1,4-dibromo-2-(5-methoxy-2-methylphenyl)benzene.
| Compound Name | 1,4-dibromo-2-(5-methoxy-2-methylphenyl)benzene |
|---|---|
| PubChem CID | 90975189 |
| Molecular Formula | C14H12Br2O |
| Molecular Weight | 356.06 g/mol |
| Exact Mass | 353.93 |
| IUPAC Name | 1,4-dibromo-2-(5-methoxy-2-methylphenyl)benzene |
| SMILES | COc1ccc(C)c(-c2cc(Br)ccc2Br)c1 |
| InChI | InChI=1S/C14H12Br2O/c1-9-3-5-11(17-2)8-12(9)13-7-10(15)4-6-14(13)16/h3-8H,1-2H3 |
| InChIKey | PEQHYYJUTQSAHJ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.06 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |