C9H6Br2O — CID 86326332
(3S)-3,5-dibromo-2,3-dihydroinden-1-one (PubChem CID 86326332) has the molecular formula C9H6Br2O and a molecular weight of 289.95 g/mol. Its IUPAC name is (3S)-3,5-dibromo-2,3-dihydroinden-1-one.
| Compound Name | (3S)-3,5-dibromo-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 86326332 |
| Molecular Formula | C9H6Br2O |
| Molecular Weight | 289.95 g/mol |
| Exact Mass | 287.88 |
| IUPAC Name | (3S)-3,5-dibromo-2,3-dihydroinden-1-one |
| SMILES | O=C1C[C@H](Br)c2cc(Br)ccc21 |
| InChI | InChI=1S/C9H6Br2O/c10-5-1-2-6-7(3-5)8(11)4-9(6)12/h1-3,8H,4H2/t8-/m0/s1 |
| InChIKey | OLNNZDYJEWDYSL-QMMMGPOBSA-N |
| XLogP | 3.47 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.95 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|