C20H24Br2 — CID 145444709
2,7-dibromo-9-methyl-10-methylidene-9H-anthracene;ethane (PubChem CID 145444709) has the molecular formula C20H24Br2 and a molecular weight of 424.22 g/mol. Its IUPAC name is 2,7-dibromo-9-methyl-10-methylidene-9H-anthracene;ethane.
| Compound Name | 2,7-dibromo-9-methyl-10-methylidene-9H-anthracene;ethane |
|---|---|
| PubChem CID | 145444709 |
| Molecular Formula | C20H24Br2 |
| Molecular Weight | 424.22 g/mol |
| Exact Mass | 422.02 |
| IUPAC Name | 2,7-dibromo-9-methyl-10-methylidene-9H-anthracene;ethane |
| SMILES | C=C1c2ccc(Br)cc2C(C)c2cc(Br)ccc21.CC.CC |
| InChI | InChI=1S/C16H12Br2.2C2H6/c1-9-13-5-3-11(17)7-15(13)10(2)16-8-12(18)4-6-14(9)16;2*1-2/h3-8,10H,1H2,2H3;2*1-2H3 |
| InChIKey | DLYVKCXMQURQOJ-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.22 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |