C13H12F3NO — CID 175181387
1-benzyl-3-(2,2,2-trifluoroethylidene)pyrrolidin-2-one (PubChem CID 175181387) has the molecular formula C13H12F3NO and a molecular weight of 255.24 g/mol. Its IUPAC name is 1-benzyl-3-(2,2,2-trifluoroethylidene)pyrrolidin-2-one.
| Compound Name | 1-benzyl-3-(2,2,2-trifluoroethylidene)pyrrolidin-2-one |
|---|---|
| PubChem CID | 175181387 |
| Molecular Formula | C13H12F3NO |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 1-benzyl-3-(2,2,2-trifluoroethylidene)pyrrolidin-2-one |
| SMILES | O=C1C(=CC(F)(F)F)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C13H12F3NO/c14-13(15,16)8-11-6-7-17(12(11)18)9-10-4-2-1-3-5-10/h1-5,8H,6-7,9H2 |
| InChIKey | WCDBJBSOKGDYMX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|