About 1-benzylpyrrolidin-2-one;methyl formate
1-benzylpyrrolidin-2-one;methyl formate (PubChem CID 143754063) has the molecular formula C13H17NO3
and a molecular weight of 235.28 g/mol. Its IUPAC name is 1-benzylpyrrolidin-2-one;methyl formate.
Molecular Properties
| Compound Name | 1-benzylpyrrolidin-2-one;methyl formate |
| PubChem CID | 143754063 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 1-benzylpyrrolidin-2-one;methyl formate |
| SMILES | COC=O.O=C1CCCN1Cc1ccccc1 |
| InChI | InChI=1S/C11H13NO.C2H4O2/c13-11-7-4-8-12(11)9-10-5-2-1-3-6-10;1-4-2-3/h1-3,5-6H,4,7-9H2;2H,1H3 |
| InChIKey | KQTUGQBSSHRXDF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-benzylpyrrolidin-2-one;methyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzylpyrrolidin-2-one;methyl formate?
The IUPAC name of 1-benzylpyrrolidin-2-one;methyl formate (CID 143754063) is 1-benzylpyrrolidin-2-one;methyl formate.
What is the SMILES notation for 1-benzylpyrrolidin-2-one;methyl formate?
The canonical SMILES for 1-benzylpyrrolidin-2-one;methyl formate is COC=O.O=C1CCCN1Cc1ccccc1.
What is the InChIKey of 1-benzylpyrrolidin-2-one;methyl formate?
The InChIKey is KQTUGQBSSHRXDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO.C2H4O2/c13-11-7-4-8-12(11)9-10-5-2-1-3-6-10;1-4-2-3/h1-3,5-6H,4,7-9H2;2H,1H3.
What are the key properties of 1-benzylpyrrolidin-2-one;methyl formate?
1-benzylpyrrolidin-2-one;methyl formate has a molecular weight of 235.28 g/mol, XLogP of 1.60, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzylpyrrolidin-2-one;methyl formate is sourced from PubChem (CID 143754063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).