C38H48N2O9 — CID 161056616
1-benzylpyrrolidin-2-one;diethyl cyclopropane-1,1-dicarboxylate;ethyl 1-[(Z)-(1-benzyl-2-oxopyrrolidin-3-ylidene)-hydroxymethyl]cyclopropane-1-carboxylate (PubChem CID 161056616) has the molecular formula C38H48N2O9 and a molecular weight of 676.81 g/mol. Its IUPAC name is 1-benzylpyrrolidin-2-one;diethyl cyclopropane-1,1-dicarboxylate;ethyl 1-[(Z)-(1-benzyl-2-oxopyrrolidin-3-ylidene)-hydroxymethyl]cyclopropane-1-carboxylate.
| Compound Name | 1-benzylpyrrolidin-2-one;diethyl cyclopropane-1,1-dicarboxylate;ethyl 1-[(Z)-(1-benzyl-2-oxopyrrolidin-3-ylidene)-hydroxymethyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 161056616 |
| Molecular Formula | C38H48N2O9 |
| Molecular Weight | 676.81 g/mol |
| Exact Mass | 676.34 |
| IUPAC Name | 1-benzylpyrrolidin-2-one;diethyl cyclopropane-1,1-dicarboxylate;ethyl 1-[(Z)-(1-benzyl-2-oxopyrrolidin-3-ylidene)-hydroxymethyl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1(/C(O)=C2\CCN(Cc3ccccc3)C2=O)CC1.CCOC(=O)C1(C(=O)OCC)CC1.O=C1CCCN1Cc1ccccc1 |
| InChI | InChI=1S/C18H21NO4.C11H13NO.C9H14O4/c1-2-23-17(22)18(9-10-18)15(20)14-8-11-19(16(14)21)12-13-6-4-3-5-7-13;13-11-7-4-8-12(11)9-10-5-2-1-3-6-10;1-3-12-7(10)9(5-6-9)8(11)13-4-2/h3-7,20H,2,8-12H2,1H3;1-3,5-6H,4,7-9H2;3-6H2,1-2H3/b15-14-;; |
| InChIKey | UCVMJIWFOIOIPJ-GEKVWEGFSA-N |
| XLogP | 5.28 |
| TPSA | 139.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.81 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|