C22H32NO3P — CID 101246300
1-[ethoxy(phenyl)phosphoryl]-N-[(1S)-2-methoxy-1-phenylethyl]-3-methylbutan-1-amine (PubChem CID 101246300) has the molecular formula C22H32NO3P and a molecular weight of 389.48 g/mol. Its IUPAC name is 1-[ethoxy(phenyl)phosphoryl]-N-[(1S)-2-methoxy-1-phenylethyl]-3-methylbutan-1-amine.
| Compound Name | 1-[ethoxy(phenyl)phosphoryl]-N-[(1S)-2-methoxy-1-phenylethyl]-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 101246300 |
| Molecular Formula | C22H32NO3P |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | 1-[ethoxy(phenyl)phosphoryl]-N-[(1S)-2-methoxy-1-phenylethyl]-3-methylbutan-1-amine |
| SMILES | CCOP(=O)(c1ccccc1)C(CC(C)C)N[C@H](COC)c1ccccc1 |
| InChI | InChI=1S/C22H32NO3P/c1-5-26-27(24,20-14-10-7-11-15-20)22(16-18(2)3)23-21(17-25-4)19-12-8-6-9-13-19/h6-15,18,21-23H,5,16-17H2,1-4H3/t21-,22?,27?/m1/s1 |
| InChIKey | HMKUFKRVOHOAES-VEODAXLASA-N |
| XLogP | 4.98 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|