C23H26NO3P — CID 134877831
[[[(1R)-2-methoxy-1-phenylethyl]amino]-(2-methylphenyl)methyl]-phenylphosphinic acid (PubChem CID 134877831) has the molecular formula C23H26NO3P and a molecular weight of 395.44 g/mol. Its IUPAC name is [[[(1R)-2-methoxy-1-phenylethyl]amino]-(2-methylphenyl)methyl]-phenylphosphinic acid.
| Compound Name | [[[(1R)-2-methoxy-1-phenylethyl]amino]-(2-methylphenyl)methyl]-phenylphosphinic acid |
|---|---|
| PubChem CID | 134877831 |
| Molecular Formula | C23H26NO3P |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | [[[(1R)-2-methoxy-1-phenylethyl]amino]-(2-methylphenyl)methyl]-phenylphosphinic acid |
| SMILES | COC[C@H](NC(c1ccccc1C)P(=O)(O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H26NO3P/c1-18-11-9-10-16-21(18)23(28(25,26)20-14-7-4-8-15-20)24-22(17-27-2)19-12-5-3-6-13-19/h3-16,22-24H,17H2,1-2H3,(H,25,26)/t22-,23?/m0/s1 |
| InChIKey | SCBHWRUIVFFZNE-NQCNTLBGSA-N |
| XLogP | 4.57 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|