C24H31NO3S2 — CID 20540920
S-[2-benzyl-3-[(1-hydroxy-6-methylsulfanylhexyl)amino]-3-oxopropyl] benzenecarbothioate (PubChem CID 20540920) has the molecular formula C24H31NO3S2 and a molecular weight of 445.65 g/mol. Its IUPAC name is S-[2-benzyl-3-[(1-hydroxy-6-methylsulfanylhexyl)amino]-3-oxopropyl] benzenecarbothioate.
| Compound Name | S-[2-benzyl-3-[(1-hydroxy-6-methylsulfanylhexyl)amino]-3-oxopropyl] benzenecarbothioate |
|---|---|
| PubChem CID | 20540920 |
| Molecular Formula | C24H31NO3S2 |
| Molecular Weight | 445.65 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | S-[2-benzyl-3-[(1-hydroxy-6-methylsulfanylhexyl)amino]-3-oxopropyl] benzenecarbothioate |
| SMILES | CSCCCCCC(O)NC(=O)C(CSC(=O)c1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H31NO3S2/c1-29-16-10-4-9-15-22(26)25-23(27)21(17-19-11-5-2-6-12-19)18-30-24(28)20-13-7-3-8-14-20/h2-3,5-8,11-14,21-22,26H,4,9-10,15-18H2,1H3,(H,25,27) |
| InChIKey | FVBITPCHIRLBRV-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.65 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|