C16H23NO2S2 — CID 151724625
2-[(2-benzyl-3-methylsulfanylpropanoyl)amino]pentanethioic S-acid (PubChem CID 151724625) has the molecular formula C16H23NO2S2 and a molecular weight of 325.50 g/mol. Its IUPAC name is 2-[(2-benzyl-3-methylsulfanylpropanoyl)amino]pentanethioic S-acid.
| Compound Name | 2-[(2-benzyl-3-methylsulfanylpropanoyl)amino]pentanethioic S-acid |
|---|---|
| PubChem CID | 151724625 |
| Molecular Formula | C16H23NO2S2 |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 2-[(2-benzyl-3-methylsulfanylpropanoyl)amino]pentanethioic S-acid |
| SMILES | CCCC(NC(=O)C(CSC)Cc1ccccc1)C(=O)S |
| InChI | InChI=1S/C16H23NO2S2/c1-3-7-14(16(19)20)17-15(18)13(11-21-2)10-12-8-5-4-6-9-12/h4-6,8-9,13-14H,3,7,10-11H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | RJHTWZIQXAROPT-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|