C26H41NO3S2 — CID 118137966
(2S)-2-[[(E)-2-benzyl-5-propyl-8-(sulfanylmethyl)dec-6-enoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 118137966) has the molecular formula C26H41NO3S2 and a molecular weight of 479.75 g/mol. Its IUPAC name is (2S)-2-[[(E)-2-benzyl-5-propyl-8-(sulfanylmethyl)dec-6-enoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[[(E)-2-benzyl-5-propyl-8-(sulfanylmethyl)dec-6-enoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 118137966 |
| Molecular Formula | C26H41NO3S2 |
| Molecular Weight | 479.75 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | (2S)-2-[[(E)-2-benzyl-5-propyl-8-(sulfanylmethyl)dec-6-enoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CCCC(/C=C/C(CC)CS)CCC(Cc1ccccc1)C(=O)N[C@@H](CCSC)C(=O)O |
| InChI | InChI=1S/C26H41NO3S2/c1-4-9-21(13-12-20(5-2)19-31)14-15-23(18-22-10-7-6-8-11-22)25(28)27-24(26(29)30)16-17-32-3/h6-8,10-13,20-21,23-24,31H,4-5,9,14-19H2,1-3H3,(H,27,28)(H,29,30)/b13-12+/t20?,21?,23?,24-/m0/s1 |
| InChIKey | QCMBUHKKTVTDDE-RYXATFLYSA-N |
| XLogP | 5.88 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.75 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|