C11H21NO3S2 — CID 10085029
(2S)-4-methylsulfanyl-2-[2-(sulfanylmethyl)pentanoylamino]butanoic acid (PubChem CID 10085029) has the molecular formula C11H21NO3S2 and a molecular weight of 279.43 g/mol. Its IUPAC name is (2S)-4-methylsulfanyl-2-[2-(sulfanylmethyl)pentanoylamino]butanoic acid.
| Compound Name | (2S)-4-methylsulfanyl-2-[2-(sulfanylmethyl)pentanoylamino]butanoic acid |
|---|---|
| PubChem CID | 10085029 |
| Molecular Formula | C11H21NO3S2 |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | (2S)-4-methylsulfanyl-2-[2-(sulfanylmethyl)pentanoylamino]butanoic acid |
| SMILES | CCCC(CS)C(=O)N[C@@H](CCSC)C(=O)O |
| InChI | InChI=1S/C11H21NO3S2/c1-3-4-8(7-16)10(13)12-9(11(14)15)5-6-17-2/h8-9,16H,3-7H2,1-2H3,(H,12,13)(H,14,15)/t8?,9-/m0/s1 |
| InChIKey | KHSZWKNOIMXVPJ-GKAPJAKFSA-N |
| XLogP | 1.65 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|