C16H16N2O4S — CID 108907176
3-[[(E)-2-(4-methylphenyl)ethenyl]carbamoylamino]benzenesulfonic acid (PubChem CID 108907176) has the molecular formula C16H16N2O4S and a molecular weight of 332.38 g/mol. Its IUPAC name is 3-[[(E)-2-(4-methylphenyl)ethenyl]carbamoylamino]benzenesulfonic acid.
| Compound Name | 3-[[(E)-2-(4-methylphenyl)ethenyl]carbamoylamino]benzenesulfonic acid |
|---|---|
| PubChem CID | 108907176 |
| Molecular Formula | C16H16N2O4S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 3-[[(E)-2-(4-methylphenyl)ethenyl]carbamoylamino]benzenesulfonic acid |
| SMILES | Cc1ccc(/C=C/NC(=O)Nc2cccc(S(=O)(=O)O)c2)cc1 |
| InChI | InChI=1S/C16H16N2O4S/c1-12-5-7-13(8-6-12)9-10-17-16(19)18-14-3-2-4-15(11-14)23(20,21)22/h2-11H,1H3,(H2,17,18,19)(H,20,21,22)/b10-9+ |
| InChIKey | PSFSSZRJSLHAEX-MDZDMXLPSA-N |
| XLogP | 3.03 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|