C15H13BrN2O4S — CID 108906803
4-[[(E)-2-(3-bromophenyl)ethenyl]carbamoylamino]benzenesulfonic acid (PubChem CID 108906803) has the molecular formula C15H13BrN2O4S and a molecular weight of 397.25 g/mol. Its IUPAC name is 4-[[(E)-2-(3-bromophenyl)ethenyl]carbamoylamino]benzenesulfonic acid.
| Compound Name | 4-[[(E)-2-(3-bromophenyl)ethenyl]carbamoylamino]benzenesulfonic acid |
|---|---|
| PubChem CID | 108906803 |
| Molecular Formula | C15H13BrN2O4S |
| Molecular Weight | 397.25 g/mol |
| Exact Mass | 395.98 |
| IUPAC Name | 4-[[(E)-2-(3-bromophenyl)ethenyl]carbamoylamino]benzenesulfonic acid |
| SMILES | O=C(N/C=C/c1cccc(Br)c1)Nc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C15H13BrN2O4S/c16-12-3-1-2-11(10-12)8-9-17-15(19)18-13-4-6-14(7-5-13)23(20,21)22/h1-10H,(H2,17,18,19)(H,20,21,22)/b9-8+ |
| InChIKey | QNXWKYBWVIKRPC-CMDGGOBGSA-N |
| XLogP | 3.49 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.25 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|