C19H19FNO3- — CID 7387430
(3R)-3-[(3,5-dimethylphenyl)methyl]-4-(4-fluoroanilino)-4-oxobutanoate (PubChem CID 7387430) has the molecular formula C19H19FNO3- and a molecular weight of 328.36 g/mol. Its IUPAC name is (3R)-3-[(3,5-dimethylphenyl)methyl]-4-(4-fluoroanilino)-4-oxobutanoate.
| Compound Name | (3R)-3-[(3,5-dimethylphenyl)methyl]-4-(4-fluoroanilino)-4-oxobutanoate |
|---|---|
| PubChem CID | 7387430 |
| Molecular Formula | C19H19FNO3- |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | (3R)-3-[(3,5-dimethylphenyl)methyl]-4-(4-fluoroanilino)-4-oxobutanoate |
| SMILES | Cc1cc(C)cc(C[C@H](CC(=O)[O-])C(=O)Nc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C19H20FNO3/c1-12-7-13(2)9-14(8-12)10-15(11-18(22)23)19(24)21-17-5-3-16(20)4-6-17/h3-9,15H,10-11H2,1-2H3,(H,21,24)(H,22,23)/p-1/t15-/m1/s1 |
| InChIKey | ASGNVVQIYFURJY-OAHLLOKOSA-M |
| XLogP | 2.38 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |