C17H21BN2O3 — CID 169082273
[4-[(2S)-2-amino-3-(3,4-dimethylanilino)-3-oxopropyl]phenyl]boronic acid (PubChem CID 169082273) has the molecular formula C17H21BN2O3 and a molecular weight of 312.18 g/mol. Its IUPAC name is [4-[(2S)-2-amino-3-(3,4-dimethylanilino)-3-oxopropyl]phenyl]boronic acid.
| Compound Name | [4-[(2S)-2-amino-3-(3,4-dimethylanilino)-3-oxopropyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 169082273 |
| Molecular Formula | C17H21BN2O3 |
| Molecular Weight | 312.18 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | [4-[(2S)-2-amino-3-(3,4-dimethylanilino)-3-oxopropyl]phenyl]boronic acid |
| SMILES | Cc1ccc(NC(=O)[C@@H](N)Cc2ccc(B(O)O)cc2)cc1C |
| InChI | InChI=1S/C17H21BN2O3/c1-11-3-8-15(9-12(11)2)20-17(21)16(19)10-13-4-6-14(7-5-13)18(22)23/h3-9,16,22-23H,10,19H2,1-2H3,(H,20,21)/t16-/m0/s1 |
| InChIKey | XABILKZEVASQTA-INIZCTEOSA-N |
| XLogP | 0.49 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.18 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|