C18H23BN2O3 — CID 169082281
[4-[(2S)-2-amino-3-oxo-3-(3-phenylpropylamino)propyl]phenyl]boronic acid (PubChem CID 169082281) has the molecular formula C18H23BN2O3 and a molecular weight of 326.21 g/mol. Its IUPAC name is [4-[(2S)-2-amino-3-oxo-3-(3-phenylpropylamino)propyl]phenyl]boronic acid.
| Compound Name | [4-[(2S)-2-amino-3-oxo-3-(3-phenylpropylamino)propyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 169082281 |
| Molecular Formula | C18H23BN2O3 |
| Molecular Weight | 326.21 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | [4-[(2S)-2-amino-3-oxo-3-(3-phenylpropylamino)propyl]phenyl]boronic acid |
| SMILES | N[C@@H](Cc1ccc(B(O)O)cc1)C(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C18H23BN2O3/c20-17(13-15-8-10-16(11-9-15)19(23)24)18(22)21-12-4-7-14-5-2-1-3-6-14/h1-3,5-6,8-11,17,23-24H,4,7,12-13,20H2,(H,21,22)/t17-/m0/s1 |
| InChIKey | DTAWVRFHLXYRRQ-KRWDZBQOSA-N |
| XLogP | -0.01 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.21 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|