C22H30N4O2S2 — CID 10388888
(2S)-2-amino-N-[2-[2-[[(2S)-2-amino-3-phenylpropanoyl]amino]ethyldisulfanyl]ethyl]-3-phenylpropanamide (PubChem CID 10388888) has the molecular formula C22H30N4O2S2 and a molecular weight of 446.64 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-[2-[[(2S)-2-amino-3-phenylpropanoyl]amino]ethyldisulfanyl]ethyl]-3-phenylpropanamide.
| Compound Name | (2S)-2-amino-N-[2-[2-[[(2S)-2-amino-3-phenylpropanoyl]amino]ethyldisulfanyl]ethyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 10388888 |
| Molecular Formula | C22H30N4O2S2 |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | (2S)-2-amino-N-[2-[2-[[(2S)-2-amino-3-phenylpropanoyl]amino]ethyldisulfanyl]ethyl]-3-phenylpropanamide |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)NCCSSCCNC(=O)[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C22H30N4O2S2/c23-19(15-17-7-3-1-4-8-17)21(27)25-11-13-29-30-14-12-26-22(28)20(24)16-18-9-5-2-6-10-18/h1-10,19-20H,11-16,23-24H2,(H,25,27)(H,26,28)/t19-,20-/m0/s1 |
| InChIKey | GZRWLIJQWTUFBI-PMACEKPBSA-N |
| XLogP | 1.74 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|