C10H7ClF5NO — CID 113336694
3-chloro-2-methyl-N-(2,3,4,5,6-pentafluorophenyl)propanamide (PubChem CID 113336694) has the molecular formula C10H7ClF5NO and a molecular weight of 287.62 g/mol. Its IUPAC name is 3-chloro-2-methyl-N-(2,3,4,5,6-pentafluorophenyl)propanamide.
| Compound Name | 3-chloro-2-methyl-N-(2,3,4,5,6-pentafluorophenyl)propanamide |
|---|---|
| PubChem CID | 113336694 |
| Molecular Formula | C10H7ClF5NO |
| Molecular Weight | 287.62 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | 3-chloro-2-methyl-N-(2,3,4,5,6-pentafluorophenyl)propanamide |
| SMILES | CC(CCl)C(=O)Nc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10H7ClF5NO/c1-3(2-11)10(18)17-9-7(15)5(13)4(12)6(14)8(9)16/h3H,2H2,1H3,(H,17,18) |
| InChIKey | YAOTVAHIARJGFJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.62 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|