C20H12F5NOS — CID 2163801
(2S)-N-(2,3,4,5,6-pentafluorophenyl)-2-phenyl-2-phenylsulfanylacetamide (PubChem CID 2163801) has the molecular formula C20H12F5NOS and a molecular weight of 409.38 g/mol. Its IUPAC name is (2S)-N-(2,3,4,5,6-pentafluorophenyl)-2-phenyl-2-phenylsulfanylacetamide.
| Compound Name | (2S)-N-(2,3,4,5,6-pentafluorophenyl)-2-phenyl-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 2163801 |
| Molecular Formula | C20H12F5NOS |
| Molecular Weight | 409.38 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | (2S)-N-(2,3,4,5,6-pentafluorophenyl)-2-phenyl-2-phenylsulfanylacetamide |
| SMILES | O=C(Nc1c(F)c(F)c(F)c(F)c1F)[C@@H](Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H12F5NOS/c21-13-14(22)16(24)18(17(25)15(13)23)26-20(27)19(11-7-3-1-4-8-11)28-12-9-5-2-6-10-12/h1-10,19H,(H,26,27)/t19-/m0/s1 |
| InChIKey | AYMZNWMCHRRXOF-IBGZPJMESA-N |
| XLogP | 5.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.38 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|