C18H15N3OS — CID 5196122
2-phenyl-2-phenylsulfanyl-N-pyrimidin-2-ylacetamide (PubChem CID 5196122) has the molecular formula C18H15N3OS and a molecular weight of 321.41 g/mol. Its IUPAC name is 2-phenyl-2-phenylsulfanyl-N-pyrimidin-2-ylacetamide.
| Compound Name | 2-phenyl-2-phenylsulfanyl-N-pyrimidin-2-ylacetamide |
|---|---|
| PubChem CID | 5196122 |
| Molecular Formula | C18H15N3OS |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 2-phenyl-2-phenylsulfanyl-N-pyrimidin-2-ylacetamide |
| SMILES | O=C(Nc1ncccn1)C(Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H15N3OS/c22-17(21-18-19-12-7-13-20-18)16(14-8-3-1-4-9-14)23-15-10-5-2-6-11-15/h1-13,16H,(H,19,20,21,22) |
| InChIKey | OGMTYYMYIJQLGK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |