C19H17N3OS — CID 17381762
N-(4-methylpyrimidin-2-yl)-2-phenyl-2-phenylsulfanylacetamide (PubChem CID 17381762) has the molecular formula C19H17N3OS and a molecular weight of 335.43 g/mol. Its IUPAC name is N-(4-methylpyrimidin-2-yl)-2-phenyl-2-phenylsulfanylacetamide.
| Compound Name | N-(4-methylpyrimidin-2-yl)-2-phenyl-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 17381762 |
| Molecular Formula | C19H17N3OS |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | N-(4-methylpyrimidin-2-yl)-2-phenyl-2-phenylsulfanylacetamide |
| SMILES | Cc1ccnc(NC(=O)C(Sc2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C19H17N3OS/c1-14-12-13-20-19(21-14)22-18(23)17(15-8-4-2-5-9-15)24-16-10-6-3-7-11-16/h2-13,17H,1H3,(H,20,21,22,23) |
| InChIKey | MXYQMKTWKBYNBG-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |