C20H20N4OS — CID 42888617
N'-(4,6-dimethylpyrimidin-2-yl)-2-phenyl-2-phenylsulfanylacetohydrazide (PubChem CID 42888617) has the molecular formula C20H20N4OS and a molecular weight of 364.47 g/mol. Its IUPAC name is N'-(4,6-dimethylpyrimidin-2-yl)-2-phenyl-2-phenylsulfanylacetohydrazide.
| Compound Name | N'-(4,6-dimethylpyrimidin-2-yl)-2-phenyl-2-phenylsulfanylacetohydrazide |
|---|---|
| PubChem CID | 42888617 |
| Molecular Formula | C20H20N4OS |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | N'-(4,6-dimethylpyrimidin-2-yl)-2-phenyl-2-phenylsulfanylacetohydrazide |
| SMILES | Cc1cc(C)nc(NNC(=O)C(Sc2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C20H20N4OS/c1-14-13-15(2)22-20(21-14)24-23-19(25)18(16-9-5-3-6-10-16)26-17-11-7-4-8-12-17/h3-13,18H,1-2H3,(H,23,25)(H,21,22,24) |
| InChIKey | HOWWMPWXKKQRBE-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|