C21H19NO2S — CID 16573615
N-(2-hydroxy-4-methylphenyl)-2-phenyl-2-phenylsulfanylacetamide (PubChem CID 16573615) has the molecular formula C21H19NO2S and a molecular weight of 349.46 g/mol. Its IUPAC name is N-(2-hydroxy-4-methylphenyl)-2-phenyl-2-phenylsulfanylacetamide.
| Compound Name | N-(2-hydroxy-4-methylphenyl)-2-phenyl-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 16573615 |
| Molecular Formula | C21H19NO2S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | N-(2-hydroxy-4-methylphenyl)-2-phenyl-2-phenylsulfanylacetamide |
| SMILES | Cc1ccc(NC(=O)C(Sc2ccccc2)c2ccccc2)c(O)c1 |
| InChI | InChI=1S/C21H19NO2S/c1-15-12-13-18(19(23)14-15)22-21(24)20(16-8-4-2-5-9-16)25-17-10-6-3-7-11-17/h2-14,20,23H,1H3,(H,22,24) |
| InChIKey | VDNDRGUHXGCIPJ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|