C21H20N2O3S — CID 7600611
2,5-dimethyl-N'-[(2R)-2-phenyl-2-phenylsulfanylacetyl]furan-3-carbohydrazide (PubChem CID 7600611) has the molecular formula C21H20N2O3S and a molecular weight of 380.47 g/mol. Its IUPAC name is 2,5-dimethyl-N'-[(2R)-2-phenyl-2-phenylsulfanylacetyl]furan-3-carbohydrazide.
| Compound Name | 2,5-dimethyl-N'-[(2R)-2-phenyl-2-phenylsulfanylacetyl]furan-3-carbohydrazide |
|---|---|
| PubChem CID | 7600611 |
| Molecular Formula | C21H20N2O3S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 2,5-dimethyl-N'-[(2R)-2-phenyl-2-phenylsulfanylacetyl]furan-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)[C@H](Sc2ccccc2)c2ccccc2)c(C)o1 |
| InChI | InChI=1S/C21H20N2O3S/c1-14-13-18(15(2)26-14)20(24)22-23-21(25)19(16-9-5-3-6-10-16)27-17-11-7-4-8-12-17/h3-13,19H,1-2H3,(H,22,24)(H,23,25)/t19-/m1/s1 |
| InChIKey | WWHDFIIGFKNKSE-LJQANCHMSA-N |
| XLogP | 4.19 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|