C22H23N3O3 — CID 134006560
1-[(2,5-dimethylfuran-3-carbonyl)amino]-3-(1,2-diphenylethyl)urea (PubChem CID 134006560) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is 1-[(2,5-dimethylfuran-3-carbonyl)amino]-3-(1,2-diphenylethyl)urea.
| Compound Name | 1-[(2,5-dimethylfuran-3-carbonyl)amino]-3-(1,2-diphenylethyl)urea |
|---|---|
| PubChem CID | 134006560 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 1-[(2,5-dimethylfuran-3-carbonyl)amino]-3-(1,2-diphenylethyl)urea |
| SMILES | Cc1cc(C(=O)NNC(=O)NC(Cc2ccccc2)c2ccccc2)c(C)o1 |
| InChI | InChI=1S/C22H23N3O3/c1-15-13-19(16(2)28-15)21(26)24-25-22(27)23-20(18-11-7-4-8-12-18)14-17-9-5-3-6-10-17/h3-13,20H,14H2,1-2H3,(H,24,26)(H2,23,25,27) |
| InChIKey | CCXASPDQAUOGGH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|