C15H25N3O3 — CID 47018404
1-[(2,5-dimethylfuran-3-carbonyl)amino]-3-heptan-2-ylurea (PubChem CID 47018404) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is 1-[(2,5-dimethylfuran-3-carbonyl)amino]-3-heptan-2-ylurea.
| Compound Name | 1-[(2,5-dimethylfuran-3-carbonyl)amino]-3-heptan-2-ylurea |
|---|---|
| PubChem CID | 47018404 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 1-[(2,5-dimethylfuran-3-carbonyl)amino]-3-heptan-2-ylurea |
| SMILES | CCCCCC(C)NC(=O)NNC(=O)c1cc(C)oc1C |
| InChI | InChI=1S/C15H25N3O3/c1-5-6-7-8-10(2)16-15(20)18-17-14(19)13-9-11(3)21-12(13)4/h9-10H,5-8H2,1-4H3,(H,17,19)(H2,16,18,20) |
| InChIKey | HXXHCARSSREZIS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|