C16H17F2N3O3 — CID 134008884
1-[1-(3,4-difluorophenyl)ethyl]-3-[(2,5-dimethylfuran-3-carbonyl)amino]urea (PubChem CID 134008884) has the molecular formula C16H17F2N3O3 and a molecular weight of 337.33 g/mol. Its IUPAC name is 1-[1-(3,4-difluorophenyl)ethyl]-3-[(2,5-dimethylfuran-3-carbonyl)amino]urea.
| Compound Name | 1-[1-(3,4-difluorophenyl)ethyl]-3-[(2,5-dimethylfuran-3-carbonyl)amino]urea |
|---|---|
| PubChem CID | 134008884 |
| Molecular Formula | C16H17F2N3O3 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 1-[1-(3,4-difluorophenyl)ethyl]-3-[(2,5-dimethylfuran-3-carbonyl)amino]urea |
| SMILES | Cc1cc(C(=O)NNC(=O)NC(C)c2ccc(F)c(F)c2)c(C)o1 |
| InChI | InChI=1S/C16H17F2N3O3/c1-8-6-12(10(3)24-8)15(22)20-21-16(23)19-9(2)11-4-5-13(17)14(18)7-11/h4-7,9H,1-3H3,(H,20,22)(H2,19,21,23) |
| InChIKey | XCCKJYLNHODHPG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|