C19H21F2N3O4 — CID 55331925
N-[1-[2-(2,5-dimethylfuran-3-carbonyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2,6-difluorobenzamide (PubChem CID 55331925) has the molecular formula C19H21F2N3O4 and a molecular weight of 393.39 g/mol. Its IUPAC name is N-[1-[2-(2,5-dimethylfuran-3-carbonyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2,6-difluorobenzamide.
| Compound Name | N-[1-[2-(2,5-dimethylfuran-3-carbonyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 55331925 |
| Molecular Formula | C19H21F2N3O4 |
| Molecular Weight | 393.39 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | N-[1-[2-(2,5-dimethylfuran-3-carbonyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]-2,6-difluorobenzamide |
| SMILES | Cc1cc(C(=O)NNC(=O)C(NC(=O)c2c(F)cccc2F)C(C)C)c(C)o1 |
| InChI | InChI=1S/C19H21F2N3O4/c1-9(2)16(22-18(26)15-13(20)6-5-7-14(15)21)19(27)24-23-17(25)12-8-10(3)28-11(12)4/h5-9,16H,1-4H3,(H,22,26)(H,23,25)(H,24,27) |
| InChIKey | ZQRRWCZMCZZXIN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|