C14H13F2N3O3 — CID 51168686
1-(2,4-difluorophenyl)-3-[(2,5-dimethylfuran-3-carbonyl)amino]urea (PubChem CID 51168686) has the molecular formula C14H13F2N3O3 and a molecular weight of 309.27 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[(2,5-dimethylfuran-3-carbonyl)amino]urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-[(2,5-dimethylfuran-3-carbonyl)amino]urea |
|---|---|
| PubChem CID | 51168686 |
| Molecular Formula | C14H13F2N3O3 |
| Molecular Weight | 309.27 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[(2,5-dimethylfuran-3-carbonyl)amino]urea |
| SMILES | Cc1cc(C(=O)NNC(=O)Nc2ccc(F)cc2F)c(C)o1 |
| InChI | InChI=1S/C14H13F2N3O3/c1-7-5-10(8(2)22-7)13(20)18-19-14(21)17-12-4-3-9(15)6-11(12)16/h3-6H,1-2H3,(H,18,20)(H2,17,19,21) |
| InChIKey | HOXWKIAHXQTADJ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.27 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|