C11H2F6O4 — CID 162516906
8-(difluoromethylidene)-2,3,4,5-tetrafluorobicyclo[4.2.0]octa-1(6),2,4-triene-7,7-dicarboxylic acid (PubChem CID 162516906) has the molecular formula C11H2F6O4 and a molecular weight of 312.12 g/mol. Its IUPAC name is 8-(difluoromethylidene)-2,3,4,5-tetrafluorobicyclo[4.2.0]octa-1(6),2,4-triene-7,7-dicarboxylic acid.
| Compound Name | 8-(difluoromethylidene)-2,3,4,5-tetrafluorobicyclo[4.2.0]octa-1(6),2,4-triene-7,7-dicarboxylic acid |
|---|---|
| PubChem CID | 162516906 |
| Molecular Formula | C11H2F6O4 |
| Molecular Weight | 312.12 g/mol |
| Exact Mass | 311.99 |
| IUPAC Name | 8-(difluoromethylidene)-2,3,4,5-tetrafluorobicyclo[4.2.0]octa-1(6),2,4-triene-7,7-dicarboxylic acid |
| SMILES | O=C(O)C1(C(=O)O)C(=C(F)F)c2c(F)c(F)c(F)c(F)c21 |
| InChI | InChI=1S/C11H2F6O4/c12-4-1-2(5(13)7(15)6(4)14)11(9(18)19,10(20)21)3(1)8(16)17/h(H,18,19)(H,20,21) |
| InChIKey | GNQRXLQSJCHAPW-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.12 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|