C10H3F7O2 — CID 125484051
2-(2,4,5,7,7,8,8-heptafluoro-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)acetic acid (PubChem CID 125484051) has the molecular formula C10H3F7O2 and a molecular weight of 288.12 g/mol. Its IUPAC name is 2-(2,4,5,7,7,8,8-heptafluoro-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)acetic acid.
| Compound Name | 2-(2,4,5,7,7,8,8-heptafluoro-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)acetic acid |
|---|---|
| PubChem CID | 125484051 |
| Molecular Formula | C10H3F7O2 |
| Molecular Weight | 288.12 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | 2-(2,4,5,7,7,8,8-heptafluoro-3-bicyclo[4.2.0]octa-1(6),2,4-trienyl)acetic acid |
| SMILES | O=C(O)Cc1c(F)c(F)c2c(c1F)C(F)(F)C2(F)F |
| InChI | InChI=1S/C10H3F7O2/c11-6-2(1-3(18)19)7(12)8(13)5-4(6)9(14,15)10(5,16)17/h1H2,(H,18,19) |
| InChIKey | ZRGIVNVLWWOGEJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.12 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|