C12H3F11O2 — CID 125484012
2-(1,3,4,5,5,6,6,7,7,8,8-undecafluoronaphthalen-2-yl)acetic acid (PubChem CID 125484012) has the molecular formula C12H3F11O2 and a molecular weight of 388.13 g/mol. Its IUPAC name is 2-(1,3,4,5,5,6,6,7,7,8,8-undecafluoronaphthalen-2-yl)acetic acid.
| Compound Name | 2-(1,3,4,5,5,6,6,7,7,8,8-undecafluoronaphthalen-2-yl)acetic acid |
|---|---|
| PubChem CID | 125484012 |
| Molecular Formula | C12H3F11O2 |
| Molecular Weight | 388.13 g/mol |
| Exact Mass | 388.00 |
| IUPAC Name | 2-(1,3,4,5,5,6,6,7,7,8,8-undecafluoronaphthalen-2-yl)acetic acid |
| SMILES | O=C(O)Cc1c(F)c(F)c2c(c1F)C(F)(F)C(F)(F)C(F)(F)C2(F)F |
| InChI | InChI=1S/C12H3F11O2/c13-6-2(1-3(24)25)7(14)8(15)5-4(6)9(16,17)11(20,21)12(22,23)10(5,18)19/h1H2,(H,24,25) |
| InChIKey | UQAQKTXQQXLNPF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.13 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|