About 2-[2,3-bis(trifluoromethyl)phenyl]acetic acid
2-[2,3-bis(trifluoromethyl)phenyl]acetic acid (PubChem CID 22556101) has the molecular formula C10H6F6O2
and a molecular weight of 272.14 g/mol. Its IUPAC name is 2-[2,3-bis(trifluoromethyl)phenyl]acetic acid.
Molecular Properties
| Compound Name | 2-[2,3-bis(trifluoromethyl)phenyl]acetic acid |
| PubChem CID | 22556101 |
| Molecular Formula | C10H6F6O2 |
| Molecular Weight | 272.14 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | 2-[2,3-bis(trifluoromethyl)phenyl]acetic acid |
| SMILES | O=C(O)Cc1cccc(C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C10H6F6O2/c11-9(12,13)6-3-1-2-5(4-7(17)18)8(6)10(14,15)16/h1-3H,4H2,(H,17,18) |
| InChIKey | OBCHIDMKONRPKC-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.14 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[2,3-bis(trifluoromethyl)phenyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,3-bis(trifluoromethyl)phenyl]acetic acid?
The IUPAC name of 2-[2,3-bis(trifluoromethyl)phenyl]acetic acid (CID 22556101) is 2-[2,3-bis(trifluoromethyl)phenyl]acetic acid.
What is the SMILES notation for 2-[2,3-bis(trifluoromethyl)phenyl]acetic acid?
The canonical SMILES for 2-[2,3-bis(trifluoromethyl)phenyl]acetic acid is O=C(O)Cc1cccc(C(F)(F)F)c1C(F)(F)F.
What is the InChIKey of 2-[2,3-bis(trifluoromethyl)phenyl]acetic acid?
The InChIKey is OBCHIDMKONRPKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6F6O2/c11-9(12,13)6-3-1-2-5(4-7(17)18)8(6)10(14,15)16/h1-3H,4H2,(H,17,18).
What are the key properties of 2-[2,3-bis(trifluoromethyl)phenyl]acetic acid?
2-[2,3-bis(trifluoromethyl)phenyl]acetic acid has a molecular weight of 272.14 g/mol, XLogP of 3.35, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,3-bis(trifluoromethyl)phenyl]acetic acid is sourced from PubChem (CID 22556101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).