C11H3F9O2 — CID 125483924
2-(1,1,2,2,3,3,4,6,7-nonafluoroinden-5-yl)acetic acid (PubChem CID 125483924) has the molecular formula C11H3F9O2 and a molecular weight of 338.13 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,4,6,7-nonafluoroinden-5-yl)acetic acid.
| Compound Name | 2-(1,1,2,2,3,3,4,6,7-nonafluoroinden-5-yl)acetic acid |
|---|---|
| PubChem CID | 125483924 |
| Molecular Formula | C11H3F9O2 |
| Molecular Weight | 338.13 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | 2-(1,1,2,2,3,3,4,6,7-nonafluoroinden-5-yl)acetic acid |
| SMILES | O=C(O)Cc1c(F)c(F)c2c(c1F)C(F)(F)C(F)(F)C2(F)F |
| InChI | InChI=1S/C11H3F9O2/c12-6-2(1-3(21)22)7(13)8(14)5-4(6)9(15,16)11(19,20)10(5,17)18/h1H2,(H,21,22) |
| InChIKey | GXGPGDREGASXKR-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.13 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|