C11HCl2F9O2 — CID 125484122
2,2-dichloro-2-(1,1,2,2,3,3,4,6,7-nonafluoroinden-5-yl)acetic acid (PubChem CID 125484122) has the molecular formula C11HCl2F9O2 and a molecular weight of 407.02 g/mol. Its IUPAC name is 2,2-dichloro-2-(1,1,2,2,3,3,4,6,7-nonafluoroinden-5-yl)acetic acid.
| Compound Name | 2,2-dichloro-2-(1,1,2,2,3,3,4,6,7-nonafluoroinden-5-yl)acetic acid |
|---|---|
| PubChem CID | 125484122 |
| Molecular Formula | C11HCl2F9O2 |
| Molecular Weight | 407.02 g/mol |
| Exact Mass | 405.92 |
| IUPAC Name | 2,2-dichloro-2-(1,1,2,2,3,3,4,6,7-nonafluoroinden-5-yl)acetic acid |
| SMILES | O=C(O)C(Cl)(Cl)c1c(F)c(F)c2c(c1F)C(F)(F)C(F)(F)C2(F)F |
| InChI | InChI=1S/C11HCl2F9O2/c12-8(13,7(23)24)3-4(14)1-2(5(15)6(3)16)10(19,20)11(21,22)9(1,17)18/h(H,23,24) |
| InChIKey | YHTGIEWAKVMNAD-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.02 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|