C13H7F9O2 — CID 125472140
ethyl 2-(1,1,2,2,3,3,4,6,7-nonafluoroinden-5-yl)acetate (PubChem CID 125472140) has the molecular formula C13H7F9O2 and a molecular weight of 366.18 g/mol. Its IUPAC name is ethyl 2-(1,1,2,2,3,3,4,6,7-nonafluoroinden-5-yl)acetate.
| Compound Name | ethyl 2-(1,1,2,2,3,3,4,6,7-nonafluoroinden-5-yl)acetate |
|---|---|
| PubChem CID | 125472140 |
| Molecular Formula | C13H7F9O2 |
| Molecular Weight | 366.18 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | ethyl 2-(1,1,2,2,3,3,4,6,7-nonafluoroinden-5-yl)acetate |
| SMILES | CCOC(=O)Cc1c(F)c(F)c2c(c1F)C(F)(F)C(F)(F)C2(F)F |
| InChI | InChI=1S/C13H7F9O2/c1-2-24-5(23)3-4-8(14)6-7(10(16)9(4)15)12(19,20)13(21,22)11(6,17)18/h2-3H2,1H3 |
| InChIKey | MWFUEQZKVRDCDA-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.18 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|