C13H6F9NO2 — CID 121407419
ethyl 2-cyano-2-[2,3,5-trifluoro-4,6-bis(trifluoromethyl)phenyl]acetate (PubChem CID 121407419) has the molecular formula C13H6F9NO2 and a molecular weight of 379.18 g/mol. Its IUPAC name is ethyl 2-cyano-2-[2,3,5-trifluoro-4,6-bis(trifluoromethyl)phenyl]acetate.
| Compound Name | ethyl 2-cyano-2-[2,3,5-trifluoro-4,6-bis(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 121407419 |
| Molecular Formula | C13H6F9NO2 |
| Molecular Weight | 379.18 g/mol |
| Exact Mass | 379.03 |
| IUPAC Name | ethyl 2-cyano-2-[2,3,5-trifluoro-4,6-bis(trifluoromethyl)phenyl]acetate |
| SMILES | CCOC(=O)C(C#N)c1c(F)c(F)c(C(F)(F)F)c(F)c1C(F)(F)F |
| InChI | InChI=1S/C13H6F9NO2/c1-2-25-11(24)4(3-23)5-6(12(17,18)19)9(15)7(13(20,21)22)10(16)8(5)14/h4H,2H2,1H3 |
| InChIKey | AKJAMNTUCPDRLJ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.18 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|