C15H6F11NO2 — CID 71747394
ethyl 2-cyano-2-(1,3,4,5,5,6,6,7,7,8,8-undecafluoronaphthalen-2-yl)acetate (PubChem CID 71747394) has the molecular formula C15H6F11NO2 and a molecular weight of 441.20 g/mol. Its IUPAC name is ethyl 2-cyano-2-(1,3,4,5,5,6,6,7,7,8,8-undecafluoronaphthalen-2-yl)acetate.
| Compound Name | ethyl 2-cyano-2-(1,3,4,5,5,6,6,7,7,8,8-undecafluoronaphthalen-2-yl)acetate |
|---|---|
| PubChem CID | 71747394 |
| Molecular Formula | C15H6F11NO2 |
| Molecular Weight | 441.20 g/mol |
| Exact Mass | 441.02 |
| IUPAC Name | ethyl 2-cyano-2-(1,3,4,5,5,6,6,7,7,8,8-undecafluoronaphthalen-2-yl)acetate |
| SMILES | CCOC(=O)C(C#N)c1c(F)c(F)c2c(c1F)C(F)(F)C(F)(F)C(F)(F)C2(F)F |
| InChI | InChI=1S/C15H6F11NO2/c1-2-29-11(28)4(3-27)5-8(16)6-7(10(18)9(5)17)13(21,22)15(25,26)14(23,24)12(6,19)20/h4H,2H2,1H3 |
| InChIKey | MDNFDFMTGZHREN-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.20 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|