C13H5F10NO2 — CID 12540847
ethyl 2-(4-cyano-2,3,5,6-tetrafluorophenyl)-3,3,3-trifluoro-2-(trifluoromethyl)propanoate (PubChem CID 12540847) has the molecular formula C13H5F10NO2 and a molecular weight of 397.17 g/mol. Its IUPAC name is ethyl 2-(4-cyano-2,3,5,6-tetrafluorophenyl)-3,3,3-trifluoro-2-(trifluoromethyl)propanoate.
| Compound Name | ethyl 2-(4-cyano-2,3,5,6-tetrafluorophenyl)-3,3,3-trifluoro-2-(trifluoromethyl)propanoate |
|---|---|
| PubChem CID | 12540847 |
| Molecular Formula | C13H5F10NO2 |
| Molecular Weight | 397.17 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | ethyl 2-(4-cyano-2,3,5,6-tetrafluorophenyl)-3,3,3-trifluoro-2-(trifluoromethyl)propanoate |
| SMILES | CCOC(=O)C(c1c(F)c(F)c(C#N)c(F)c1F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H5F10NO2/c1-2-26-10(25)11(12(18,19)20,13(21,22)23)5-8(16)6(14)4(3-24)7(15)9(5)17/h2H2,1H3 |
| InChIKey | GAQOSXWAGKIZGW-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.17 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|