C13H21F3O6S — CID 126611132
methyl 2,2-dimethyl-3-[4-(trifluoromethylsulfonyloxy)cyclohexyl]oxypropanoate (PubChem CID 126611132) has the molecular formula C13H21F3O6S and a molecular weight of 362.37 g/mol. Its IUPAC name is methyl 2,2-dimethyl-3-[4-(trifluoromethylsulfonyloxy)cyclohexyl]oxypropanoate.
| Compound Name | methyl 2,2-dimethyl-3-[4-(trifluoromethylsulfonyloxy)cyclohexyl]oxypropanoate |
|---|---|
| PubChem CID | 126611132 |
| Molecular Formula | C13H21F3O6S |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | methyl 2,2-dimethyl-3-[4-(trifluoromethylsulfonyloxy)cyclohexyl]oxypropanoate |
| SMILES | COC(=O)C(C)(C)COC1CCC(OS(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H21F3O6S/c1-12(2,11(17)20-3)8-21-9-4-6-10(7-5-9)22-23(18,19)13(14,15)16/h9-10H,4-8H2,1-3H3 |
| InChIKey | WONMLVLKOSPJGE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|