C6H12O5S — CID 117059672
3-methoxy-2,2-dimethyl-3-oxopropane-1-sulfonic acid (PubChem CID 117059672) has the molecular formula C6H12O5S and a molecular weight of 196.22 g/mol. Its IUPAC name is 3-methoxy-2,2-dimethyl-3-oxopropane-1-sulfonic acid.
| Compound Name | 3-methoxy-2,2-dimethyl-3-oxopropane-1-sulfonic acid |
|---|---|
| PubChem CID | 117059672 |
| Molecular Formula | C6H12O5S |
| Molecular Weight | 196.22 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | 3-methoxy-2,2-dimethyl-3-oxopropane-1-sulfonic acid |
| SMILES | COC(=O)C(C)(C)CS(=O)(=O)O |
| InChI | InChI=1S/C6H12O5S/c1-6(2,5(7)11-3)4-12(8,9)10/h4H2,1-3H3,(H,8,9,10) |
| InChIKey | GBHKKLDLEQZZHK-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.22 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|