methyl 2,2-dimethyl-3-propan-2-ylsulfonylpropanoate

C9H18O4S — CID 79629782

IUPACmethyl 2,2-dimethyl-3-propan-2-ylsulfonylpropanoate
SMILESCOC(=O)C(C)(C)CS(=O)(=O)C(C)C
InChIInChI=1S/C9H18O4S/c1-7(2)14(11,12)6-9(3,4)8(10)13-5/h7H,6H2,1-5H3
InChIKeyKZZBTPUZVVFAFQ-UHFFFAOYSA-N
MW222.31 g/mol
LogP1.01
Rot. Bonds4

About methyl 2,2-dimethyl-3-propan-2-ylsulfonylpropanoate

methyl 2,2-dimethyl-3-propan-2-ylsulfonylpropanoate (PubChem CID 79629782) has the molecular formula C9H18O4S and a molecular weight of 222.31 g/mol. Its IUPAC name is methyl 2,2-dimethyl-3-propan-2-ylsulfonylpropanoate.

Molecular Properties

Compound Namemethyl 2,2-dimethyl-3-propan-2-ylsulfonylpropanoate
PubChem CID79629782
Molecular FormulaC9H18O4S
Molecular Weight222.31 g/mol
Exact Mass222.09
IUPAC Namemethyl 2,2-dimethyl-3-propan-2-ylsulfonylpropanoate
SMILESCOC(=O)C(C)(C)CS(=O)(=O)C(C)C
InChIInChI=1S/C9H18O4S/c1-7(2)14(11,12)6-9(3,4)8(10)13-5/h7H,6H2,1-5H3
InChIKeyKZZBTPUZVVFAFQ-UHFFFAOYSA-N
XLogP1.01
TPSA60.44 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500222.31
LogP ≤ 51.01
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 2,2-dimethyl-3-propan-2-ylsulfonylpropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2,2-dimethyl-3-propan-2-ylsulfonylpropanoate?
The IUPAC name of methyl 2,2-dimethyl-3-propan-2-ylsulfonylpropanoate (CID 79629782) is methyl 2,2-dimethyl-3-propan-2-ylsulfonylpropanoate.
What is the SMILES notation for methyl 2,2-dimethyl-3-propan-2-ylsulfonylpropanoate?
The canonical SMILES for methyl 2,2-dimethyl-3-propan-2-ylsulfonylpropanoate is COC(=O)C(C)(C)CS(=O)(=O)C(C)C.
What is the InChIKey of methyl 2,2-dimethyl-3-propan-2-ylsulfonylpropanoate?
The InChIKey is KZZBTPUZVVFAFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O4S/c1-7(2)14(11,12)6-9(3,4)8(10)13-5/h7H,6H2,1-5H3.
What are the key properties of methyl 2,2-dimethyl-3-propan-2-ylsulfonylpropanoate?
methyl 2,2-dimethyl-3-propan-2-ylsulfonylpropanoate has a molecular weight of 222.31 g/mol, XLogP of 1.01, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,2-dimethyl-3-propan-2-ylsulfonylpropanoate is sourced from PubChem (CID 79629782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).